CAS 825635-46-9
:1-[({[4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzyl]oxy}carbonyl)oxy]pyrrolidine-2,5-dione
Description:
1-[({[4-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)benzyl]oxy}carbonyl)oxy]pyrrolidine-2,5-dione, with CAS number 825635-46-9, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and multiple functional groups. The presence of a nonafluorohexyl group imparts unique properties, such as increased hydrophobicity and potential applications in surface modification and materials science. The compound features a carbonyl group, which contributes to its reactivity and potential as a building block in organic synthesis. Additionally, the benzyl ether moiety enhances its solubility in organic solvents. The fluorinated alkyl chain is known for its stability and resistance to chemical degradation, making this compound of interest in various fields, including pharmaceuticals and advanced materials. Its unique characteristics may also lead to applications in areas such as drug delivery systems or as a surfactant in specialized formulations. Overall, this compound exemplifies the intersection of organic chemistry and materials science, showcasing the versatility of fluorinated compounds.
Formula:C18H14F9NO5
InChI:InChI=1/C18H14F9NO5/c19-15(20,16(21,22)17(23,24)18(25,26)27)8-7-10-1-3-11(4-2-10)9-32-14(31)33-28-12(29)5-6-13(28)30/h1-4H,5-9H2
SMILES:c1cc(ccc1CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)COC(=O)ON1C(=O)CCC1=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.