CymitQuimica logo

CAS 825638-02-6

:

4-(2-Methylphenyl)-6-(4-methyl-1-piperazinyl)-3-pyridinecarbonitrile

Description:
4-(2-Methylphenyl)-6-(4-methyl-1-piperazinyl)-3-pyridinecarbonitrile, identified by its CAS number 825638-02-6, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carbonitrile functional group, and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the piperazine group suggests possible interactions with biological targets, particularly in the central nervous system, as piperazine derivatives are often explored for their pharmacological effects. Additionally, the methylphenyl and methyl groups may influence the compound's lipophilicity and overall reactivity. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its efficacy and safety in various biological assays. Overall, this compound represents a class of molecules that could have significant implications in medicinal chemistry and drug development.
Formula:C18H20N4
InChI:InChI=1S/C18H20N4/c1-14-5-3-4-6-16(14)17-11-18(20-13-15(17)12-19)22-9-7-21(2)8-10-22/h3-6,11,13H,7-10H2,1-2H3
InChI key:InChIKey=HVWMPCSXFINWER-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=CC(=NC1)N2CCN(C)CC2)C3=C(C)C=CC=C3
Synonyms:
  • 4-(2-Methylphenyl)-6-(4-methyl-1-piperazinyl)-3-pyridinecarbonitrile
  • 6-(4-Methylpiperazin-1-yl)-4-o-tolylnicotinonitrile
  • 3-Pyridinecarbonitrile, 4-(2-methylphenyl)-6-(4-methyl-1-piperazinyl)-
  • 6-(4-Methylpiperazin-1-yl)-4-(o-tolyl)nicotinonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.