CAS 82565-68-2
:fmoc-4-iodo-L-phenylalanine
Description:
Fmoc-4-iodo-L-phenylalanine is a derivative of the amino acid phenylalanine, modified with a 9-fluorenylmethoxycarbonyl (Fmoc) protecting group and an iodine atom at the para position of the phenyl ring. This compound is primarily used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), where the Fmoc group serves as a protective group for the amino functionality, allowing for selective deprotection and coupling reactions. The presence of the iodine atom enhances the compound's reactivity and can facilitate specific labeling or functionalization in biochemical applications. Fmoc-4-iodo-L-phenylalanine is typically a white to off-white solid, and its solubility varies depending on the solvent used, often being soluble in organic solvents like dimethyl sulfoxide (DMSO) and less so in water. Its molecular structure contributes to its utility in synthesizing peptides with unique properties, making it valuable in research and pharmaceutical development. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C24H20INO4
InChI:InChI=1/C24H20INO4/c25-16-11-9-15(10-12-16)13-22(23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](Cc1ccc(cc1)I)C(=O)O)O
Synonyms:- Fmoc-L-4-Iodophenylalanine
- Fmoc-Phe(4-I)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Fmoc-4-Iodo-L-phenylalanine
CAS:M01925 - Fmoc-4-Iodo-L-phenylalanine
Formula:C24H20INO4Purity:95%Color and Shape:SolidMolecular weight:513.331N-Fmoc-4-iodo-L-phenylalanine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C24H20INO4Purity:95%Molecular weight:513.33Fmoc-4-Iodo-L-phenylalanine
CAS:Formula:C24H20INO4Purity:96%Color and Shape:SolidMolecular weight:513.3244Fmoc-Phe(4-I)-OH
CAS:Formula:C24H20INO4Purity:≥ 98.0%Color and Shape:White powderMolecular weight:513.334-Iodo-L-phenylalanine, N-FMOC protected
CAS:4-Iodo-L-phenylalanine, N-FMOC protectedFormula:C24H20INO4Purity:97%Color and Shape: white solidMolecular weight:513.32g/mol




