CAS 825657-70-3

2-amino-N-[2-(cyclohex-1-en-1-yl)ethyl]benzamide

Description:

2-amino-N-[2-(cyclohex-1-en-1-yl)ethyl]benzamide, identified by its CAS number 825657-70-3, is an organic compound characterized by its amine and amide functional groups. This substance features a benzamide structure, where an amino group is attached to the benzene ring, enhancing its potential for hydrogen bonding and solubility in polar solvents. The presence of a cyclohexene moiety introduces a degree of unsaturation and contributes to the compound's overall hydrophobic character. The cyclohexene ring can also influence the compound's stereochemistry and reactivity, making it of interest in various chemical reactions and applications. The compound's molecular structure suggests potential biological activity, which may be explored in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Overall, 2-amino-N-[2-(cyclohex-1-en-1-yl)ethyl]benzamide represents a unique structure that may have implications in both synthetic and pharmaceutical chemistry.

Formula: C₁₅H₂₀N₂O

InChI: InChI=1/C15H20N2O/c16-14-9-5-4-8-13(14)15(18)17-11-10-12-6-2-1-3-7-12/h4-6,8-9H,1-3,7,10-11,16H2,(H,17,18)

SMILES: C1CC=C(CC1)CCN=C(c1ccccc1N)O

Synonyms:

• benzamide, 2-amino-N-[2-(1-cyclohexen-1-yl)ethyl]-
• 2-Amino-N-[2-(cyclohex-1-en-1-yl)ethyl]benzamide