CAS 82570-34-1

(1S,2S,4R,8S)-1-methyl-3-methylidene-8-(propan-2-yl)tricyclo[4.4.0.0~2,7~]decan-4-ol

Description:

The chemical substance known as (1S,2S,4R,8S)-1-methyl-3-methylidene-8-(propan-2-yl)tricyclo[4.4.0.0^2,7]decan-4-ol, with the CAS number 82570-34-1, is a bicyclic compound characterized by a complex tricyclic structure. This compound features multiple stereocenters, which contribute to its chiral nature, influencing its reactivity and interactions in biological systems. The presence of a hydroxyl group (-OH) indicates that it is an alcohol, which can participate in hydrogen bonding, affecting its solubility and boiling point. The methylidene and isopropyl substituents introduce additional steric hindrance and can influence the compound's overall stability and reactivity. Such compounds are often studied for their potential applications in pharmaceuticals, fragrances, or as intermediates in organic synthesis. The specific stereochemistry and functional groups present in this molecule can lead to unique properties, making it of interest in various fields of chemistry and material science.

Formula: C₁₅H₂₄O

InChI: InChI=1/C15H24O/c1-8(2)10-5-6-15(4)11-7-12(16)9(3)14(15)13(10)11/h8,10-14,16H,3,5-7H2,1-2,4H3/t10-,11?,12+,13?,14?,15-/m0/s1

Lemnalol

CAS: 82570-34-1

Lemnalol, from Lemnalia cervicorni, has anti-inflammatory and analgesic properties.

Formula: C₁₅H₂₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 220.35

Ref: TM-T25658