CAS 82578-46-9
:Butyl (3R)-3-hydroxybutanoate
Description:
Butyl (3R)-3-hydroxybutanoate, with the CAS number 82578-46-9, is an ester derived from butanol and 3-hydroxybutanoic acid. This compound typically appears as a colorless to pale yellow liquid with a characteristic fruity odor, which is common among esters. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic butyl group. The presence of the hydroxy group contributes to its reactivity, allowing it to participate in various chemical reactions, such as esterification and transesterification. This compound is often used in the synthesis of pharmaceuticals, flavoring agents, and fragrances, owing to its pleasant aroma and potential biological activity. Additionally, its stereochemistry, indicated by the (3R) configuration, may influence its interactions in biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H16O3
InChI:InChI=1S/C8H16O3/c1-3-4-5-11-8(10)6-7(2)9/h7,9H,3-6H2,1-2H3/t7-/m1/s1
InChI key:InChIKey=LHDWRKCOQQHAMP-SSDOTTSWSA-N
SMILES:O(C(C[C@@H](C)O)=O)CCCC
Synonyms:- Butyl (R)-3-hydroxybutanoate
- Butanoic acid, 3-hydroxy-, butyl ester, (3R)-
- Butanoic acid, 3-hydroxy-, butyl ester, (R)-
- Butyl (3R)-3-hydroxybutanoate
- Butanoicacid, 3-hydroxy-, butyl ester, (R)-
- Butyl (R)-3-hydroxybutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.