CAS 82583-95-7

2-amino-5-methoxy-4-(phenoxymethyl)benzaldehyde

Description:

2-Amino-5-methoxy-4-(phenoxymethyl)benzaldehyde, with the CAS number 82583-95-7, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features an amino group (-NH2) and a methoxy group (-OCH3) on the benzene ring, contributing to its reactivity and potential applications in organic synthesis. The phenoxymethyl substituent enhances its solubility and may influence its biological activity. Typically, compounds like this can exhibit properties such as fluorescence or serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. The presence of both electron-donating (methoxy) and electron-withdrawing (aldehyde) groups can affect the compound's reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions or condensation reactions. Additionally, the compound's structure suggests potential interactions with biological targets, which may warrant investigation in medicinal chemistry. Overall, 2-amino-5-methoxy-4-(phenoxymethyl)benzaldehyde represents a versatile building block in organic chemistry.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1/C15H15NO3/c1-18-15-8-11(9-17)14(16)7-12(15)10-19-13-5-3-2-4-6-13/h2-9H,10,16H2,1H3

SMILES: COc1cc(C=O)c(cc1COc1ccccc1)N