CymitQuimica logo

CAS 82584-78-9

:

methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate

Description:
Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate, with the CAS number 82584-78-9, is an organic compound characterized by its unique bicyclic structure that incorporates a benzofuran moiety. This compound features a carbonyl group (ketone) and an ester functional group, which contribute to its reactivity and potential applications in organic synthesis. The tetrahydro structure indicates that it is a saturated derivative of benzofuran, which may influence its physical properties, such as solubility and boiling point. Typically, compounds of this nature exhibit moderate polarity, making them soluble in organic solvents. Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate may be of interest in medicinal chemistry due to its potential biological activity, as many benzofuran derivatives have been studied for their pharmacological properties. Additionally, its structural features may allow for further derivatization, making it a valuable intermediate in the synthesis of more complex molecules. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C10H10O4
InChI:InChI=1/C10H10O4/c1-13-10(12)6-5-14-8-4-2-3-7(11)9(6)8/h5H,2-4H2,1H3
SMILES:COC(=O)c1coc2CCCC(=O)c12
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.