CAS 82585-34-0

2-amino-1-(4-fluorophenyl)ethanone oxime

Description:

2-amino-1-(4-fluorophenyl)ethanone oxime, with the CAS number 82585-34-0, is an organic compound characterized by its oxime functional group, which is derived from the reaction of an aldehyde or ketone with hydroxylamine. This compound features an amino group and a fluorophenyl moiety, indicating the presence of a fluorine atom on the phenyl ring, which can influence its chemical reactivity and biological activity. The oxime group typically exhibits properties such as being a weak base and can participate in various chemical reactions, including condensation and rearrangement. The presence of the fluorine atom may enhance lipophilicity and alter the compound's interaction with biological targets. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and synthesis. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 2-amino-1-(4-fluorophenyl)ethanone oxime represents a versatile structure in organic synthesis and pharmaceutical research.

Formula: C₈H₉FN₂O

InChI: InChI=1/C8H9FN2O/c9-7-3-1-6(2-4-7)8(5-10)11-12/h1-4,12H,5,10H2/b11-8+

Synonyms:

• (1Z)-2-Amino-1-(4-fluorphenyl)ethanonoxim
• (2Z)-2-(4-Fluorophenyl)-2-(hydroxyimino)ethanamine
• ethanone, 2-amino-1-(4-fluorophenyl)-, oxime, (1Z)-