CymitQuimica logo

CAS 82586-78-5

:

(Z)-N-methyl-N'-{2-[({2-[(methylamino)methyl]-1,3-thiazol-4-yl}methyl)sulfanyl]ethyl}-2-nitroethene-1,1-diamine

Description:
(Z)-N-methyl-N'-{2-[({2-[(methylamino)methyl]-1,3-thiazol-4-yl}methyl)sulfanyl]ethyl}-2-nitroethene-1,1-diamine is a complex organic compound characterized by its unique structural features, including a thiazole ring, a nitroethene moiety, and multiple amine functionalities. The presence of a methylamino group suggests potential for hydrogen bonding and reactivity, while the thiazole ring contributes to its biological activity and stability. The compound's sulfanyl group indicates the presence of sulfur, which can influence its chemical reactivity and interactions with other molecules. The (Z) configuration denotes a specific geometric arrangement around the double bond, which can affect the compound's physical properties and biological activity. This substance may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its complex structure suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties, including solubility, stability, and reactivity under different conditions.
Formula:C11H19N5O2S2
InChI:InChI=1/C11H19N5O2S2/c1-12-5-11-15-9(8-20-11)7-19-4-3-14-10(13-2)6-16(17)18/h6,8,12-14H,3-5,7H2,1-2H3/b10-6-
SMILES:CNCc1nc(CSCCN/C(=C\N(=O)=O)/NC)cs1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.