CAS 82588-42-9

6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde

Description:

6-(4-Methylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde is a heterocyclic organic compound characterized by its imidazole and thiazole rings, which contribute to its unique chemical properties. The presence of the 4-methylphenyl group enhances its aromatic character and may influence its reactivity and solubility. This compound features an aldehyde functional group, which is known for its reactivity in various chemical reactions, including condensation and oxidation. The imidazo[2,1-b][1,3]thiazole framework is significant in medicinal chemistry, often associated with biological activity, making this compound of interest for potential pharmaceutical applications. Its molecular structure suggests it may exhibit properties such as fluorescence or specific interactions with biological targets. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are critical factors for its practical applications in research and industry. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry due to its structural complexity and potential utility.

Formula: C₁₃H₁₀N₂OS

InChI: InChI=1/C13H10N2OS/c1-9-2-4-10(5-3-9)12-11(8-16)15-6-7-17-13(15)14-12/h2-8H,1H3

SMILES: Cc1ccc(cc1)c1c(C=O)n2ccsc2n1

Synonyms:

• Imidazo[2,1-b]thiazole-5-carboxaldehyde, 6-(4-methylphenyl)-
• 6-(4-Methylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde

6-(p-Tolyl)imidazo[2,1-b]thiazole-5-carbaldehyde

CAS: 82588-42-9

Formula: C₁₃H₁₀N₂OS

Color and Shape: Solid

Molecular weight: 242.2963

Ref: IN-DA004XN2