
CAS 82588-43-0
:6-[1,1′-Biphenyl]-4-ylimidazo[2,1-b]thiazole-5-carboxaldehyde
Description:
6-[1,1′-Biphenyl]-4-ylimidazo[2,1-b]thiazole-5-carboxaldehyde is a chemical compound characterized by its complex structure, which includes an imidazo-thiazole core fused with a biphenyl moiety. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of both nitrogen and sulfur atoms in the imidazo-thiazole ring enhances its biological activity, making it a subject of interest in drug discovery and development. The biphenyl group can influence the compound's electronic properties and hydrophobicity, potentially affecting its interactions with biological targets. Additionally, the compound's unique structure may exhibit fluorescence properties, which can be useful in various analytical applications. Overall, 6-[1,1′-Biphenyl]-4-ylimidazo[2,1-b]thiazole-5-carboxaldehyde represents a versatile scaffold for further chemical modifications and investigations into its pharmacological potential.
Formula:C18H12N2OS
InChI:InChI=1S/C18H12N2OS/c21-12-16-17(19-18-20(16)10-11-22-18)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H
InChI key:InChIKey=FJLRPDKLIBVBFD-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N=C2N1C=CS2)C3=CC=C(C=C3)C4=CC=CC=C4
Synonyms:- NSC 332729
- 6-[1,1′-Biphenyl]-4-ylimidazo[2,1-b]thiazole-5-carboxaldehyde
- Imidazo[2,1-b]thiazole-5-carboxaldehyde, 6-[1,1′-biphenyl]-4-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.