CymitQuimica logo

CAS 82588-60-1

:

[6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanol

Description:
The chemical substance known as [6-(4-methylphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methanol, with the CAS number 82588-60-1, is characterized by its complex molecular structure, which includes an imidazole ring fused to a thiazole moiety. This compound features a 4-methylphenyl substituent, contributing to its aromatic properties and potentially influencing its biological activity. The presence of a hydroxymethyl group indicates that it can participate in hydrogen bonding, which may enhance its solubility and reactivity in various chemical environments. The imidazo-thiazole framework is often associated with diverse pharmacological activities, making such compounds of interest in medicinal chemistry. Additionally, the presence of the methyl group on the phenyl ring can affect the compound's lipophilicity and overall stability. Overall, this substance may exhibit unique chemical properties that could be explored for potential applications in drug development or other chemical processes.
Formula:C13H12N2OS
InChI:InChI=1/C13H12N2OS/c1-9-2-4-10(5-3-9)12-11(8-16)15-6-7-17-13(15)14-12/h2-7,16H,8H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.