CAS 82593-41-7
:5,6-Diamino-1-(2-furanylmethyl)-3-methyl-2,4(1H,3H)-pyrimidinedione
Description:
5,6-Diamino-1-(2-furanylmethyl)-3-methyl-2,4(1H,3H)-pyrimidinedione, with the CAS number 82593-41-7, is a synthetic organic compound characterized by its pyrimidinedione core structure, which features two amino groups at the 5 and 6 positions and a furanylmethyl substituent at the 1 position. This compound exhibits properties typical of pyrimidine derivatives, including potential biological activity due to the presence of the amino groups, which can participate in hydrogen bonding and enhance solubility in polar solvents. The furanylmethyl group may contribute to its reactivity and interaction with biological targets. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as pyrimidine derivatives are often explored for their antiviral, anticancer, and antimicrobial properties. Its stability, solubility, and reactivity can vary based on environmental conditions, making it a subject of study in various chemical and pharmaceutical contexts.
Formula:C10H12N4O3
InChI:InChI=1S/C10H12N4O3/c1-13-9(15)7(11)8(12)14(10(13)16)5-6-3-2-4-17-6/h2-4H,5,11-12H2,1H3
InChI key:InChIKey=VSHHHMTVOVUEIM-UHFFFAOYSA-N
SMILES:C(N1C(N)=C(N)C(=O)N(C)C1=O)C2=CC=CO2
Synonyms:- 5,6-Diamino-1-(2-furanylmethyl)-3-methyl-2,4(1H,3H)-pyrimidinedione
- 2,4(1H,3H)-Pyrimidinedione, 5,6-diamino-1-(2-furanylmethyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6-Diamino-1-(2-furanylmethyl)-3-methyl-2,4(1H,3H)-pyrimidinedione
CAS:Controlled ProductFormula:C10H12N4O3Color and Shape:NeatMolecular weight:236.23
