CymitQuimica logo

CAS 82597-82-8

:

Cyclo(-Phe-Trp)

Description:
Cyclo(-Phe-Trp) is a cyclic dipeptide composed of phenylalanine (Phe) and tryptophan (Trp) residues. This compound features a unique cyclic structure that can influence its biological activity and stability compared to its linear counterparts. The cyclic nature of Cyclo(-Phe-Trp) can enhance its resistance to enzymatic degradation, making it of interest in pharmaceutical applications. It exhibits properties typical of peptides, such as solubility in polar solvents and the ability to form hydrogen bonds, which can affect its interaction with biological targets. Additionally, the aromatic side chains of phenylalanine and tryptophan contribute to its hydrophobic characteristics, potentially influencing its binding affinity and specificity in biological systems. Cyclo(-Phe-Trp) may also exhibit various biological activities, including antimicrobial and antioxidant properties, making it a subject of interest in medicinal chemistry and drug design. Overall, the unique structural features of Cyclo(-Phe-Trp) contribute to its potential utility in various biochemical and therapeutic contexts.
Formula:C20H19N3O2
InChI:InChI=1/C20H19N3O2/c24-19-17(10-13-6-2-1-3-7-13)22-20(25)18(23-19)11-14-12-21-16-9-5-4-8-15(14)16/h1-9,12,17-18,21H,10-11H2,(H,22,25)(H,23,24)
SMILES:c1ccc(cc1)CC1C(=NC(Cc2c[nH]c3ccccc23)C(=N1)O)O
Synonyms:
  • 2,5-Piperazinedione, 3-(1H-indol-3-ylmethyl)-6-(phenylmethyl)-
  • 3-benzyl-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.