CymitQuimica logo

CAS 82603-70-1

:

Methyl 1,4-dihydro-2,4-dioxo-3(2H)-quinazolinepropanoate

Description:
Methyl 1,4-dihydro-2,4-dioxo-3(2H)-quinazolinepropanoate, with the CAS number 82603-70-1, is a chemical compound that belongs to the class of quinazoline derivatives. This substance typically exhibits a bicyclic structure, characterized by a quinazoline ring fused with a propanoate moiety. It is known for its potential biological activities, which may include antimicrobial, anti-inflammatory, or anticancer properties, making it of interest in pharmaceutical research. The presence of the dioxo functional groups contributes to its reactivity and potential interactions with biological targets. Additionally, the methyl ester group enhances its solubility in organic solvents, which can be advantageous for various applications in organic synthesis and medicinal chemistry. As with many quinazoline derivatives, the compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. However, detailed studies are necessary to fully elucidate its properties and potential applications in various fields.
Formula:C12H12N2O4
InChI:InChI=1S/C12H12N2O4/c1-18-10(15)6-7-14-11(16)8-4-2-3-5-9(8)13-12(14)17/h2-5H,6-7H2,1H3,(H,13,17)
InChI key:InChIKey=QCXFSVRWBCAHKW-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(=O)N1CCC(OC)=O)=CC=CC2
Synonyms:
  • 3(2H)-Quinazolinepropanoic acid, 1,4-dihydro-2,4-dioxo-, methyl ester
  • Methyl 1,4-dihydro-2,4-dioxo-3(2H)-quinazolinepropanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.