CAS 82608-90-0

3-chloro-2-methyl-N-sulfinylaniline

Description:

3-Chloro-2-methyl-N-sulfinylaniline is an organic compound characterized by its aromatic amine structure, which includes a chloro group and a sulfinyl functional group. The presence of the chloro substituent at the 3-position and a methyl group at the 2-position on the aniline ring influences its reactivity and solubility. The sulfinyl group, which is a sulfur atom bonded to an oxygen atom, contributes to the compound's potential as a nucleophile and may enhance its biological activity. This compound is typically used in various chemical syntheses and may have applications in pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. As with many chemical compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with this compound.

Formula: C₇H₆ClNOS

InChI: InChI=1/C7H6ClNOS/c1-5-6(8)3-2-4-7(5)9-11-10/h2-4H,1H3

SMILES: Cc1c(cccc1N=S=O)Cl

Synonyms:

• 3-Chloro-2-methyl-N-sulfinylbenzenamine
• Benzenamine, 3-chloro-2-methyl-N-sulfinyl-, (Z)-