CAS 82611-49-2

N2-[(1,1-Dimethylethoxy)carbonyl]-N6-[(phenylmethoxy)carbonyl]-D-lysine methyl ester

Description:

N2-[(1,1-Dimethylethoxy)carbonyl]-N6-[(phenylmethoxy)carbonyl]-D-lysine methyl ester, with CAS number 82611-49-2, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a lysine backbone, which is an essential amino acid, modified with two distinct protective groups: a 1,1-dimethylethoxycarbonyl group at the N2 position and a phenylmethoxycarbonyl group at the N6 position. These modifications enhance the compound's stability and solubility, making it suitable for various applications in peptide synthesis and medicinal chemistry. The presence of the methyl ester group contributes to its lipophilicity, potentially influencing its bioavailability and interaction with biological systems. The compound is typically characterized by its molecular structure, which can be analyzed using techniques such as NMR spectroscopy and mass spectrometry. Overall, this compound serves as a valuable intermediate in the synthesis of more complex peptides and can be utilized in research related to drug development and biochemical studies.

Formula: C₂₀H₃₀N₂O₆

InChI: InChI=1S/C20H30N2O6/c1-20(2,3)28-19(25)22-16(17(23)26-4)12-8-9-13-21-18(24)27-14-15-10-6-5-7-11-15/h5-7,10-11,16H,8-9,12-14H2,1-4H3,(H,21,24)(H,22,25)/t16-/m1/s1

InChI key: InChIKey=PUJVYJATJHQXRX-MRXNPFEDSA-N

SMILES: [C@@H](NC(OC(C)(C)C)=O)(CCCCNC(OCC1=CC=CC=C1)=O)C(OC)=O

Synonyms:

• N2-[(1,1-Dimethylethoxy)carbonyl]-N6-[(phenylmethoxy)carbonyl]-D-lysine methyl ester
• D-Lysine, N2-[(1,1-dimethylethoxy)carbonyl]-N6-[(phenylmethoxy)carbonyl]-, methyl ester