CymitQuimica logo

CAS 82611-51-6

:

2-[(3R)-3-(tert-butoxycarbonylamino)-2-oxo-1-piperidyl]acetic acid

Description:
2-[(3R)-3-(tert-butoxycarbonylamino)-2-oxo-1-piperidyl]acetic acid, with the CAS number 82611-51-6, is a chemical compound characterized by its structure, which includes a piperidine ring and an acetic acid moiety. The presence of the tert-butoxycarbonyl (Boc) group indicates that this compound is likely used in peptide synthesis or as an intermediate in organic synthesis, providing protection for the amino group during reactions. The compound exhibits properties typical of amino acids, including the ability to form hydrogen bonds and participate in various chemical reactions due to its functional groups. Its stereochemistry, specifically the (3R) configuration, suggests that it may exhibit specific biological activity or interact with biological systems in a particular manner. The compound's solubility, stability, and reactivity can vary depending on the pH and solvent conditions, making it important for applications in pharmaceuticals or biochemistry. Overall, this compound is significant in the context of synthetic organic chemistry and potential therapeutic applications.
Formula:C12H20N2O5
InChI:InChI=1/C12H20N2O5/c1-12(2,3)19-11(18)13-8-5-4-6-14(10(8)17)7-9(15)16/h8H,4-7H2,1-3H3,(H,13,18)(H,15,16)/t8-/m1/s1
SMILES:CC(C)(C)OC(=N[C@@H]1CCCN(CC(=O)O)C1=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.