CAS 82619-62-3
:5-(furan-2-yl)pyrazin-2-ol
Description:
5-(Furan-2-yl)pyrazin-2-ol is an organic compound characterized by its unique structure, which features a pyrazine ring substituted with a furan moiety and a hydroxyl group. This compound typically exhibits a molecular formula that reflects its heterocyclic nature, incorporating both nitrogen and oxygen atoms. The presence of the furan ring contributes to its aromatic properties, while the hydroxyl group can influence its solubility and reactivity, making it potentially useful in various chemical reactions and applications. The compound may display biological activity, which is often explored in medicinal chemistry for potential therapeutic uses. Its synthesis generally involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 5-(furan-2-yl)pyrazin-2-ol represents a class of compounds that are of interest in both academic research and industrial applications due to their diverse chemical properties and potential functionalities.
Formula:C8H6N2O2
InChI:InChI=1/C8H6N2O2/c11-8-5-9-6(4-10-8)7-2-1-3-12-7/h1-5H,(H,10,11)
SMILES:c1cc(c2c[nH]c(=O)cn2)oc1
Synonyms:- 2(1H)-pyrazinone, 5-(2-furanyl)-
- 2-Pyrazinol, 5-(2-Furanyl)-
- 5-(2-Furyl)-2(1H)-pyrazinon
- 5-(2-Furyl)-2(1H)-pyrazinone
- 5-(2-Furyl)pyrazin-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
