CAS 82625-37-4
:2-[2-(4-methylpiperazin-1-yl)ethoxy]benzaldehyde
Description:
2-[2-(4-methylpiperazin-1-yl)ethoxy]benzaldehyde, with the CAS number 82625-37-4, is an organic compound characterized by its benzaldehyde functional group, which is a key feature of aromatic aldehydes. This compound contains a piperazine moiety, specifically a 4-methylpiperazine, which contributes to its potential biological activity and solubility properties. The ethoxy group serves as a linker between the benzaldehyde and the piperazine, enhancing its structural complexity. Typically, compounds of this nature may exhibit properties such as moderate to high polarity due to the presence of both the ether and aldehyde functional groups. They may also engage in hydrogen bonding, influencing their solubility in various solvents. The presence of the piperazine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperazine derivatives are often associated with various biological activities. Overall, this compound's unique structure may lead to interesting chemical reactivity and biological interactions, making it a subject of interest in research and development.
Formula:C14H20N2O2
InChI:InChI=1/C14H20N2O2/c1-15-6-8-16(9-7-15)10-11-18-14-5-3-2-4-13(14)12-17/h2-5,12H,6-11H2,1H3
SMILES:CN1CCN(CC1)CCOc1ccccc1C=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.