CAS 82625-41-0
:2-(4-morpholinobutoxy)benzaldehyde
Description:
2-(4-Morpholinobutoxy)benzaldehyde is an organic compound characterized by its benzaldehyde functional group, which is substituted with a morpholinobutoxy side chain. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the morpholine ring contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ring's ability to engage in hydrogen bonding and its favorable pharmacokinetic properties. The compound may also exhibit various functional properties, including potential antimicrobial or anti-inflammatory activities, although specific biological activities would depend on further empirical studies. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2-(4-morpholinobutoxy)benzaldehyde represents a versatile intermediate in organic synthesis and medicinal chemistry.
Formula:C15H21NO3
InChI:InChI=1/C15H21NO3/c17-13-14-5-1-2-6-15(14)19-10-4-3-7-16-8-11-18-12-9-16/h1-2,5-6,13H,3-4,7-12H2
SMILES:c1ccc(c(c1)C=O)OCCCCN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.