CAS 82625-44-3
:3-[3-(4-Morpholinyl)propoxy]benzaldehyde
Description:
3-[3-(4-Morpholinyl)propoxy]benzaldehyde, with the CAS number 82625-44-3, is an organic compound characterized by its aromatic aldehyde structure. It features a benzaldehyde moiety, which is a benzene ring with a formyl group (-CHO) attached, and a propoxy side chain that includes a morpholine ring. The morpholine group contributes to the compound's potential solubility in polar solvents and may influence its biological activity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its properties include moderate volatility and reactivity due to the presence of the aldehyde functional group, which can participate in various chemical reactions, such as condensation and oxidation. Additionally, the morpholine ring can impart unique pharmacological properties, making this compound of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H19NO3
InChI:InChI=1S/C14H19NO3/c16-12-13-3-1-4-14(11-13)18-8-2-5-15-6-9-17-10-7-15/h1,3-4,11-12H,2,5-10H2
InChI key:InChIKey=REBMYEPAUNCQQR-UHFFFAOYSA-N
SMILES:O(CCCN1CCOCC1)C2=CC(C=O)=CC=C2
Synonyms:- Benzaldehyde, 3-[3-(4-morpholinyl)propoxy]-
- 3-[3-(4-Morpholinyl)propoxy]benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.