CAS 82626-74-2
:6-Chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridine-3-acetic acid
Description:
6-Chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridine-3-acetic acid is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both chlorine and phenyl groups. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. The presence of the imidazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The chlorine substituents can influence the compound's reactivity and interaction with biological targets, potentially enhancing its efficacy or altering its pharmacokinetic properties. Additionally, the acetic acid functional group may impart acidic characteristics, affecting its behavior in various chemical environments. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C15H10Cl2N2O2
InChI:InChI=1S/C15H10Cl2N2O2/c16-10-3-1-9(2-4-10)15-12(7-14(20)21)19-8-11(17)5-6-13(19)18-15/h1-6,8H,7H2,(H,20,21)
InChI key:InChIKey=IMKILIAPBKFUTO-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(N=C2N1C=C(Cl)C=C2)C3=CC=C(Cl)C=C3
Synonyms:- 2-(6-Chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl)acetic acid
- 6-Chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridine-3-acetic acid
- Imidazo[1,2-a]pyridine-3-acetic acid, 6-chloro-2-(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.