CAS 82632-77-7

4-(4-Chlorophenyl)-5-methylthiazol-2-amine

Description:

4-(4-Chlorophenyl)-5-methylthiazol-2-amine, with the CAS number 82632-77-7, is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing sulfur and nitrogen atoms. This compound features a 4-chlorophenyl group, indicating the presence of a chlorine atom on a phenyl ring, which can influence its biological activity and solubility. The methyl group at the 5-position of the thiazole ring contributes to its overall hydrophobic character. This compound is often studied for its potential pharmaceutical applications, particularly in the field of medicinal chemistry, due to its structural features that may interact with biological targets. Its properties, such as solubility, melting point, and reactivity, can vary based on the specific conditions and solvents used. Additionally, the presence of the amine functional group suggests potential for further chemical modifications, making it a versatile candidate for drug development and research in various chemical applications.

Formula: C₁₀H₉ClN₂S

InChI: InChI=1/C10H9ClN2S/c1-6-9(13-10(12)14-6)7-2-4-8(11)5-3-7/h2-5H,1H3,(H2,12,13)

SMILES: Cc1c(c2ccc(cc2)Cl)[nH]c(=N)s1

Synonyms:

• Scrc-2941-18
• 4-(4-Chlorophenyl)-5-Methyl-1,3-Thiazol-2-Amine

2-Amino-4-(4-chlorophenyl)-5-methylthiazole

CAS: 82632-77-7

Formula: C₁₀H₉ClN₂S

Purity: >98.0%(GC)

Color and Shape: White to Yellow powder to crystal

Molecular weight: 224.71

Ref: 3B-A3066

4-(4-Chlorophenyl)-5-methyl-1,3-thiazol-2-amine

CAS: 82632-77-7

Formula: C₁₀H₉ClN₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 224.7099

Ref: IN-DA008K5N

4-(4-Chlorophenyl)-5-methylthiazol-2-amine

CAS: 82632-77-7

4-(4-Chlorophenyl)-5-methylthiazol-2-amine

Purity: 95%

Molecular weight: 224.72g/mol

Ref: 54-OR1075127

4-(4-Chloro-phenyl)-5-methyl-thiazol-2-ylamine

CAS: 82632-77-7

Formula: C₁₀H₉ClN₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 224.71

Ref: 10-F015775

4-(4-Chlorophenyl)-5-methylthiazol-2-amine

CAS: 82632-77-7

4-(4-Chlorophenyl)-5-methylthiazol-2-amine is a potent inhibitor of osteoblast function. It inhibits the production of interleukin-6, which is a cytokine that regulates inflammation and bone resorption. 4-(4-Chlorophenyl)-5-methylthiazol-2-amine also has an inhibitory effect on thiourea, a natural compound that is formed in the body during the process of purine metabolism. This compound is synthesized by methylation of 4-(4-chlorophenyl)thiazole (TCP). The residuals from this synthesis are excreted in urine as 4-(4-chlorophenyl)thiazol (TCT).

Formula: C₁₀H₉ClN₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 224.71 g/mol

Ref: 3D-FC53944