CAS 82632-78-8

2-Chloro-N-[4-(4-chlorophenyl)-5-methyl-2-thiazolyl]acetamide

Description:

2-Chloro-N-[4-(4-chlorophenyl)-5-methyl-2-thiazolyl]acetamide, with the CAS number 82632-78-8, is a chemical compound characterized by its thiazole ring and acetamide functional group. It features a chloro substituent on the acetamide nitrogen and a chlorophenyl group attached to the thiazole, contributing to its potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents, due to the presence of the thiazole moiety, which is known for its biological significance. The compound's reactivity may be influenced by the presence of the chlorine atoms, which can affect its interaction with biological targets. Safety data should be consulted for handling and usage, as compounds with similar structures may pose health risks. Overall, 2-Chloro-N-[4-(4-chlorophenyl)-5-methyl-2-thiazolyl]acetamide represents a compound of interest in medicinal chemistry and related fields.

Formula: C₁₂H₁₀Cl₂N₂OS

InChI: InChI=1S/C12H10Cl2N2OS/c1-7-11(8-2-4-9(14)5-3-8)16-12(18-7)15-10(17)6-13/h2-5H,6H2,1H3,(H,15,16,17)

InChI key: InChIKey=MQXGWXADRZNWGN-UHFFFAOYSA-N

SMILES: CC1=C(N=C(NC(CCl)=O)S1)C2=CC=C(Cl)C=C2

Synonyms:

• 2-Chloro-N-[4-(4-chlorophenyl)-5-methyl-2-thiazolyl]acetamide
• 2-Chloro-N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]acetamide
• Acetamide, 2-chloro-N-[4-(4-chlorophenyl)-5-methyl-2-thiazolyl]-

2-Chloro-N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]acetamide

CAS: 82632-78-8

Versatile small molecule scaffold

Formula: C₁₂H₁₀Cl₂N₂OS

Purity: Min. 95%

Molecular weight: 301.2 g/mol

Ref: 3D-HDA63278