CAS 82637-88-5

2,3,4,9-Tetrahydro-6-hydroxy-1H-pyrido[3,4-b]indole-3-carboxylic acid

Description:

2,3,4,9-Tetrahydro-6-hydroxy-1H-pyrido[3,4-b]indole-3-carboxylic acid, with the CAS number 82637-88-5, is a chemical compound that belongs to the class of indole derivatives. This substance features a bicyclic structure that incorporates both pyridine and indole moieties, contributing to its unique chemical properties. It is characterized by the presence of multiple functional groups, including a carboxylic acid and a hydroxyl group, which can influence its solubility and reactivity. The compound is typically studied for its potential biological activities, including neuroprotective effects and interactions with various biological targets. Its structural complexity allows for diverse interactions in biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its application and study. Overall, this compound represents a fascinating area of research within the field of organic and medicinal chemistry.

Formula: C₁₂H₁₂N₂O₃

InChI: InChI=1S/C12H12N2O3/c15-6-1-2-9-7(3-6)8-4-10(12(16)17)13-5-11(8)14-9/h1-3,10,13-15H,4-5H2,(H,16,17)

InChI key: InChIKey=UYSJXVJOZSYXFJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC=2C=3C(NC2CN1)=CC=C(O)C3

Synonyms:

• 2,3,4,9-Tetrahydro-6-hydroxy-1H-pyrido[3,4-b]indole-3-carboxylic acid
• 1H-Pyrido[3,4-b]indole-3-carboxylic acid, 2,3,4,9-tetrahydro-6-hydroxy-, (±)-
• 1H-Pyrido[3,4-b]indole-3-carboxylic acid, 2,3,4,9-tetrahydro-6-hydroxy-

6-Hydroxy-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-3-carboxylic acid

CAS: 82637-88-5

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 232.23 g/mol

Ref: 3D-HDA63788