CAS 82657-72-5
:1-(Bromomethyl)-2-phenoxybenzene
Description:
1-(Bromomethyl)-2-phenoxybenzene, with the CAS number 82657-72-5, is an organic compound characterized by the presence of a bromomethyl group and a phenoxybenzene moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It features a bromine atom attached to a methyl group, which is further connected to a phenyl ring that is substituted with a phenoxy group. The presence of the bromine atom makes it a useful intermediate in organic synthesis, particularly in the formation of carbon-carbon bonds through nucleophilic substitution reactions. Additionally, the phenoxy group can enhance the compound's solubility in organic solvents, making it versatile for various applications in chemical synthesis and material science. Its reactivity is influenced by the electron-withdrawing nature of the bromine atom, which can affect the compound's stability and interaction with other reagents. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine.
Formula:C13H11BrO
InChI:InChI=1S/C13H11BrO/c14-10-11-6-4-5-9-13(11)15-12-7-2-1-3-8-12/h1-9H,10H2
InChI key:InChIKey=YQRIQBOWLXRKKG-UHFFFAOYSA-N
SMILES:O(C1=C(CBr)C=CC=C1)C2=CC=CC=C2
Synonyms:- 1-(Bromomethyl)-2-Phenoxybenzene
- Benzene, 1-(bromomethyl)-2-phenoxy-
- Ether, α-bromo-o-tolyl phenyl
- 2-Phenoxybenzyl bromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Phenoxybenzyl bromide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C13H11BrOPurity:97%Color and Shape:Liquid, Clear pale yellowMolecular weight:263.132-Phenoxybenzyl bromide
CAS:2-Phenoxybenzyl bromidePurity:≥95%Color and Shape:LiquidMolecular weight:263.13g/mol1-(Bromomethyl)-2-phenoxybenzene
CAS:Controlled ProductFormula:C13H11BrOColor and Shape:NeatMolecular weight:263.13


