CAS 82658-22-8

16-hydroxy-11,12-dimethoxy-3a-methyl-1,2,3a,4-tetrahydrochromeno[2',3':6,7]naphtho[2,1-g][1,3]oxazolo[3,2-b]isoquinoline-8,14,15,17-tetrone

Description:

The chemical substance known as "16-hydroxy-11,12-dimethoxy-3a-methyl-1,2,3a,4-tetrahydrochromeno[2',3':6,7]naphtho[2,1-g][1,3]oxazolo[3,2-b]isoquinoline-8,14,15,17-tetrone" with CAS number 82658-22-8 is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple functional groups such as hydroxyl (-OH) and methoxy (-OCH3) groups. This compound is likely to exhibit significant biological activity due to its structural features, which may influence its interaction with biological targets. The presence of multiple rings and heteroatoms suggests potential for diverse chemical reactivity and solubility properties. Additionally, the compound's molecular weight and specific stereochemistry can affect its pharmacokinetics and pharmacodynamics if it is studied for medicinal applications. Overall, this substance represents a fascinating area of study in organic chemistry and medicinal chemistry, with potential implications in drug development and therapeutic applications.

Formula: C₂₉H₂₁NO₉

InChI: InChI=1/C29H21NO9/c1-29-11-13-8-12-4-5-14-21(19(12)25(33)20(13)28(35)30(29)6-7-38-29)26(34)22-23(31)15-9-17(36-2)18(37-3)10-16(15)39-27(22)24(14)32/h4-5,8-10,33H,6-7,11H2,1-3H3

SMILES: CC12Cc3cc4ccc5c(c4c(c3C(=O)N1CCO2)O)C(=O)c1c(=O)c2cc(c(cc2oc1C5=O)OC)OC

Cervinomycin A2; AM-5344-A2; 167-B

CAS: 82658-22-8

Formula: C₂₉H₂₁NO₉

Purity: 91.4%

Color and Shape: Bright orange. Powder.

Molecular weight: 528.0

Ref: 8R-CL0029

Cervinomycin A2

CAS: 82658-22-8

Cervinomycin A2 is an antibiotic effective against anaerobic bacteria, isolated from the Streptomyces genus, specifically Cervinomycetes. It exhibits strong inhibitory effects on Clostridium perfringens, Peptostreptococcus, and Bacteroides fragilis.

Formula: C₂₉H₂₁NO₉

Color and Shape: Solid

Molecular weight: 527.48

Ref: TM-TN7827

Cervinomycin A2

CAS: 82658-22-8

Cervinomycin A2

Color and Shape: Orange Powder

Molecular weight: 527.48g/mol

Ref: 54-BIBR1022

Cervinomycin A2

CAS: 82658-22-8

Cervinomycin A2 is an antibiotic, specifically a type of polyketide, which is sourced from certain Streptomyces species. These bacteria, known for their prolific production of bioactive compounds, produce Cervinomycin A2 as part of their natural metabolism. The mode of action of Cervinomycin A2 involves inhibiting protein synthesis in susceptible bacteria by binding to the bacterial ribosome. This mechanism is typical for antibiotics that obstruct bacterial proliferation, making them effective against a range of Gram-positive bacteria.

Formula: C₂₉H₂₁NO₉

Purity: Min. 95%

Molecular weight: 527.50 g/mol

Ref: 3D-HDA65822