CAS 82668-50-6

(1H-Pyrazol-3-yl)acetic acid ethyl ester

Description:

(1H-Pyrazol-3-yl)acetic acid ethyl ester, with the CAS number 82668-50-6, is an organic compound characterized by its pyrazole ring structure, which contributes to its unique chemical properties. This compound features an ethyl ester functional group, making it a derivative of acetic acid. It is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. The presence of the pyrazole moiety suggests potential biological activity, as pyrazoles are known for their diverse pharmacological properties, including anti-inflammatory and analgesic effects. The compound may also exhibit reactivity typical of esters, such as hydrolysis under acidic or basic conditions. Its synthesis often involves the reaction of pyrazole derivatives with acetic acid or its derivatives. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, (1H-Pyrazol-3-yl)acetic acid ethyl ester is of interest in both synthetic organic chemistry and potential medicinal applications.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1/C7H10N2O2/c1-2-11-7(10)5-6-3-4-8-9-6/h3-4H,2,5H2,1H3,(H,8,9)

SMILES: CCOC(=O)Cc1cc[nH]n1

(1H-PYRAZOL-3-YL)ACETIC ACID ETHYL ESTER

CAS: 82668-50-6

Formula: C₇H₁₀N₂O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 154.1665

Ref: IN-DA008JYB

Ethyl 2-(1H-pyrazol-3-yl)acetate

CAS: 82668-50-6

Ethyl 2-(1H-pyrazol-3-yl)acetate

Purity: 98%

Molecular weight: 154.17g/mol

Ref: 54-OR94025

(1H-PYRAZOL-3-YL)-ACETIC ACID ETHYL ESTER

CAS: 82668-50-6

Formula: C₇H₁₀N₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 154.169

Ref: 10-F513039