CAS 82671-02-1
:2,6-Dichloro-3-cyano-5-fluoropyridine
Description:
2,6-Dichloro-3-cyano-5-fluoropyridine is a heterocyclic organic compound characterized by its pyridine ring, which contains multiple substituents that influence its chemical properties. The presence of two chlorine atoms at the 2 and 6 positions, a cyano group at the 3 position, and a fluorine atom at the 5 position contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. The cyano group introduces a strong electron-withdrawing effect, which can enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, the halogen substituents can influence the compound's lipophilicity and bioavailability. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2,6-Dichloro-3-cyano-5-fluoropyridine is a versatile compound with significant implications in chemical synthesis and research.
Formula:C6HCl2FN2
InChI:InChI=1/C6H2Cl2FNO2/c7-4-2(6(11)12)1-3(9)5(8)10-4/h1H,(H,11,12)
SMILES:c1c(c(Cl)nc(c1F)Cl)C(=O)O
Synonyms:- 3-Cyano-2,6-Dichloro-5-Fluoro pyridine
- 2,6-Dichloro-3-cyano-5-fluoro pyridine
- 3-cyano-5-fluoro-2,6-Dihydroxypyridine
- 2,6-Dichloro-5-fluoro-3-pyridinecarbonitrile
- 3-Cyano-2,6-dichloro-5-fluoropyridine
- 5-Fluoro-2,6-Dichloronicotinonotrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Dichloro-5-fluoro-3-pyridinecarbonitrile
CAS:Formula:C6HCl2FN2Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:190.992,6-Dichloro-5-fluoronicotinonitrile
CAS:Formula:C6HCl2FN2Purity:97%Color and Shape:SolidMolecular weight:190.98992,6-Dichloro-5-fluoronicotinonitrile
CAS:2,6-Dichloro-5-fluoronicotinonitrileFormula:C6HCl2FN2Purity:98%Color and Shape: beige to brown crystalline solidMolecular weight:190.99g/mol2,6-Dichloro-3-cyano-5-fluoropyridine
CAS:2,6-Dichloro-3-cyano-5-fluoropyridine is an inorganic compound that is a salt. It has the chemical formula CHClFNO and a molecular weight of 215.4 g/mol. The compound is soluble in water and ethanol, but insoluble in ether. It has a melting point of about -60 degrees Celsius. The compound can react with amines to form 2,6-dichloro-3-(2H)-pyridinone, which can be converted into other compounds via chlorinating or hydrolyzing the imidazole ring. This compound reacts with ethyl bromoacetate to form a monosodium salt at temperatures between 0 and 60 degrees Celsius. 2,6-Dichloro-3-cyano-5-fluoropyridine also reacts with chlorine to produce dichlorofluoropyridine, which can be oxidized by nitricFormula:C6HCl2FN2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:190.99 g/mol2,6-Dichloro-3-cyano-5-fluoropyridine
CAS:Formula:C6HCl2FN2Purity:97%Color and Shape:SolidMolecular weight:190.99




