CAS 82683-51-0
:spiro[4.5]decane-7,9-dione
Description:
Spiro[4.5]decane-7,9-dione is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features two carbonyl (C=O) functional groups located at the 7 and 9 positions of the decane framework, contributing to its reactivity and potential applications in organic synthesis. The presence of these carbonyl groups typically enhances the compound's electrophilic character, making it useful in various chemical reactions, such as nucleophilic additions. The spiro configuration imparts rigidity to the molecular structure, influencing its physical properties, such as boiling and melting points, as well as its solubility in different solvents. Additionally, spiro[4.5]decane-7,9-dione may exhibit interesting biological activities, which could be explored for potential pharmaceutical applications. Overall, this compound represents a fascinating example of spirocyclic chemistry, with implications in both synthetic and medicinal chemistry.
Formula:C10H14O2
InChI:InChI=1/C10H14O2/c11-8-5-9(12)7-10(6-8)3-1-2-4-10/h1-7H2
SMILES:C1CCC2(C1)CC(=O)CC(=O)C2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Spiro[4.5]decane-7,9-dione
CAS:Formula:C10H14O2Purity:97%Color and Shape:SolidMolecular weight:166.2170Spiro[4.5]decane-7,9-dione
CAS:<p>Spiro[4.5]decane-7,9-dione is a crystalline compound that belongs to the class of organic solvents. It has been shown to form hydrogen bonds and halogen bonds with amides, as well as a hydrogen chloride bond with a phenyl ring. This compound also forms dihedral angles with the ethyl acetate group, which may be due to its ability to hydrogenate other molecules. Spiro[4.5]decane-7,9-dione can also bind buspirone, an anxiolytic drug that is used for the treatment of generalized anxiety disorder and other conditions.</p>Formula:C10H14O2Purity:Min. 95%Molecular weight:166.22 g/mol



