CAS 82695-07-6
:2-Pentyne, 4-methyl-, homopolymer
Description:
2-Pentyne, 4-methyl-, homopolymer, identified by CAS number 82695-07-6, is a synthetic polymer derived from the polymerization of 2-pentyne, a linear alkyne with a five-carbon chain and a triple bond between the second and third carbon atoms. This polymer exhibits characteristics typical of alkyne-based polymers, including a relatively high degree of rigidity and strength due to the presence of the triple bond in its monomeric units. The presence of the methyl group at the fourth carbon introduces branching, which can affect the polymer's physical properties, such as its melting point, solubility, and mechanical strength. Generally, polymers of this type may demonstrate good thermal stability and resistance to chemical degradation. They can be utilized in various applications, including coatings, adhesives, and potentially in the production of specialty materials. However, specific properties such as molecular weight, density, and thermal behavior would depend on the polymerization conditions and the degree of polymerization achieved.
Formula:(C6H10)x
InChI:InChI=1S/C6H10/c1-4-5-6(2)3/h6H,1-3H3
InChI key:InChIKey=SLMFWJQZLPEDDU-UHFFFAOYSA-N
SMILES:C(C(C)C)#CC
Synonyms:- 2-Pentyne, 4-methyl-, homopolymer
- Poly(4-methyl-2-pentyne)
- 4-Methyl-2-pentyne homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
