CAS 826995-55-5
:4-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid
Description:
4-(Trifluoromethyl)-1-benzothiophene-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzothiophene core substituted with a trifluoromethyl group and a carboxylic acid functional group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. The benzothiophene moiety contributes to the compound's aromatic properties and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its interaction with biological targets. Additionally, the carboxylic acid group may facilitate hydrogen bonding and solubility in polar solvents, making it suitable for various chemical reactions and applications. Overall, 4-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid is a versatile compound with potential uses in pharmaceuticals, agrochemicals, and materials science.
Formula:C10H5F3O2S
InChI:InChI=1/C10H5F3O2S/c11-10(12,13)6-2-1-3-7-5(6)4-8(16-7)9(14)15/h1-4H,(H,14,15)
SMILES:c1cc(c2cc(C(=O)O)sc2c1)C(F)(F)F
Synonyms:- 4-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid
- Benzo[b]thiophene-2-carboxylic acid, 4-(trifluoromethyl)-
- T56 Bsj Cvq Fxfff
- 4-(Trifluoromethyl)-1-benzothiophene-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid
CAS:Formula:C10H5F3O2SPurity:98%Color and Shape:SolidMolecular weight:246.20574-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid
CAS:4-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acidFormula:C10H5F3O2SPurity:≥95%Color and Shape:PowderMolecular weight:246.21g/mol4-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid
CAS:Formula:C10H5F3O2SPurity:98%Color and Shape:SolidMolecular weight:246.24-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid
CAS:<p>4-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid (TFBTS) is an agrochemical with a methyl and ethyl ester moiety. It is an active compound that is used as a fungicide and insecticide in agricultural crops. TFBTS has been shown to be effective against the growth of fungi, such as Botrytis cinerea, and insects, such as the Colorado potato beetle.</p>Formula:C10H5F3O2SPurity:Min. 95%Molecular weight:246.21 g/mol



