CAS 826995-56-6

4,6-Difluorobenzo[b]thiophene-2-carboxylic acid

Description:

4,6-Difluorobenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring system substituted with two fluorine atoms and a carboxylic acid functional group. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can affect solubility and interactions with other molecules. This compound may exhibit interesting properties in various applications, including pharmaceuticals, agrochemicals, and materials science, due to the electron-withdrawing effects of the fluorine substituents and the heterocyclic nature of the thiophene ring. Additionally, the compound's structure may allow for specific interactions in biological systems, making it a candidate for further research in medicinal chemistry. Overall, 4,6-Difluorobenzo[b]thiophene-2-carboxylic acid is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₉H₄F₂O₂S

InChI: InChI=1S/C9H4F2O2S/c10-4-1-6(11)5-3-8(9(12)13)14-7(5)2-4/h1-3H,(H,12,13)

InChI key: InChIKey=RLSMMULSYJJIAT-UHFFFAOYSA-N

SMILES: FC1=C2C(SC(C(O)=O)=C2)=CC(F)=C1

Synonyms:

• Benzo[b]thiophene-2-carboxylic acid, 4,6-difluoro-
• 4,6-Difluorobenzo[b]thiophene-2-carboxylic acid