CAS 826995-57-7

6-bromo-4-fluoro-benzothiophene-2-carboxylic acid

Description:

6-Bromo-4-fluoro-benzothiophene-2-carboxylic acid is a heterocyclic organic compound characterized by its benzothiophene structure, which incorporates both a bromine and a fluorine atom as substituents. The presence of the carboxylic acid functional group contributes to its acidic properties, making it soluble in polar solvents. This compound is notable for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the halogen substituents, which can participate in various chemical reactions such as nucleophilic substitutions. The benzothiophene core provides a stable aromatic system, enhancing the compound's overall stability and reactivity. Additionally, the specific arrangement of the bromine and fluorine atoms can influence the compound's electronic properties, potentially affecting its biological activity. As with many halogenated compounds, care should be taken regarding environmental and health impacts, as halogens can introduce toxicity or persistence in biological systems. Overall, 6-bromo-4-fluoro-benzothiophene-2-carboxylic acid is a compound of interest in synthetic organic chemistry and materials science.

Formula: C₉H₄BrFO₂S

InChI: InChI=1/C9H4BrFO2S/c10-4-1-6(11)5-3-8(9(12)13)14-7(5)2-4/h1-3H,(H,12,13)

SMILES: c1c(cc2c(cc(C(=O)O)s2)c1F)Br

Synonyms:

• 6-Bromo-4-Fluoro-1-Benzothiophene-2-Carboxylic Acid
• 6-Bromo-4-Fluorobenzo[B]Thiophene-2-Carboxylic Acid
• Benzo[b]thiophene-2-carboxylic acid, 6-bromo-4-fluoro-
• 6-bromo-4-fluoro-benzothiophene-2-carboxylic acid

6-Bromo-4-fluorobenzo[b]thiophene-2-carboxylic acid

CAS: 826995-57-7

6-Bromo-4-fluorobenzo[b]thiophene-2-carboxylic acid

Formula: C₉H₄BrFO₂S

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 275.09g/mol

Ref: 54-PC502533