CAS 827-16-7
:1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione
Description:
1,3,5-Trimethyl-1,3,5-triazinane-2,4,6-trione, commonly known as melamine, is an organic compound with the molecular formula C3H6N6O3. It is characterized by its white crystalline appearance and is highly soluble in water. Melamine is a nitrogen-rich compound, which contributes to its use in various applications, particularly in the production of resins and plastics. It exhibits a high thermal stability and is resistant to fire, making it suitable for use in materials that require durability and heat resistance. Additionally, melamine is known for its ability to form strong bonds with formaldehyde, leading to the creation of melamine-formaldehyde resins, which are widely used in laminates, adhesives, and coatings. However, it is important to note that melamine can be toxic in high concentrations, particularly in food products, where it has been associated with health risks. Overall, melamine's unique chemical properties make it a valuable compound in industrial applications, while also necessitating careful handling and regulation.
Formula:C6H9N3O3
InChI:InChI=1/C6H9N3O3/c1-7-4(10)8(2)6(12)9(3)5(7)11/h1-3H3
SMILES:Cn1c(=O)n(C)c(=O)n(C)c1=O
Synonyms:- 1,3,5-triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trimethyl-
- 1,3,5-Trimethylcyanuric Acid
- s-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-trimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3,5-Trimethyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione
CAS:Formula:C6H9N3O3Purity:95%Color and Shape:SolidMolecular weight:171.1540Trimethyl-1,3,5-triazinane-2,4,6-trione
CAS:Trimethyl-1,3,5-triazinane-2,4,6-trionePurity:95%Molecular weight:171.16g/molTrimethyl-1,3,5-triazinane-2,4,6-trione
CAS:Trimethyl-1,3,5-triazinane-2,4,6-trione is a molecule that belongs to the class of aliphatic hydrocarbons. It is an ester compound that has reactive properties and can be used as a crosslinking agent. Trimethyl-1,3,5-triazinane-2,4,6-trione reacts with calcium carbonate to form trimethylcalcium carbonate. The reactive properties of this molecule are due to the presence of nitrogen atoms and divalent hydrocarbon groups. Trimethyl-1,3,5-triazinane-2,4,6-trione also reacts with fatty acids to produce monocarboxylic acid and fatty acid molecules. Molecular modelling studies have shown that trimethyl-1,3,5-triazinane-2,4,6-trione forms linear molecules. Linear regression analysis has been used to determineFormula:C6H9N3O3Purity:Min. 95%Molecular weight:171.15 g/mol



