
CAS 827-37-2
:Calcium urate
Description:
Calcium urate is a chemical compound that is a salt formed from uric acid and calcium. It is typically found in the form of white crystalline powder or solid. The compound is characterized by its relatively low solubility in water, which can lead to its precipitation in biological systems, particularly in conditions where uric acid levels are elevated, such as gout. Calcium urate is often associated with the formation of kidney stones and can contribute to joint inflammation when deposited in tissues. Its molecular structure includes calcium ions (Ca²⁺) and urate anions (C5H3N4O3), reflecting its origin from the deprotonation of uric acid. In terms of its chemical behavior, calcium urate can undergo various reactions, particularly in acidic or basic environments, influencing its solubility and stability. Understanding its properties is essential in medical and biochemical contexts, especially concerning disorders related to uric acid metabolism.
Formula:C5H4N4O3Ca
InChI:InChI=1S/C5H4N4O3.Ca/c10-3-1-2(7-4(11)6-1)8-5(12)9-3;/h(H4,6,7,8,9,10,11,12);
InChI key:InChIKey=QWGFUHWTOHWEFY-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=O)N2)NC(=O)N1.[Ca]
Synonyms:- Uric acid, calcium salt (2:1)
- 1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, calcium salt (2:1)
- Calcium urate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.