CAS 827-43-0
:2-Phenyl-4-methylimidazole
Description:
2-Phenyl-4-methylimidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a phenyl group and a methyl group attached to the imidazole ring, contributing to its unique chemical properties. It is typically a white to light yellow crystalline solid and is known for its role as a catalyst in various chemical reactions, particularly in the field of polymer chemistry and as a curing agent in epoxy resins. The presence of the phenyl group enhances its stability and solubility in organic solvents, while the methyl group can influence its reactivity. 2-Phenyl-4-methylimidazole exhibits moderate toxicity and should be handled with care, following appropriate safety protocols. Its applications extend to pharmaceuticals and materials science, where it serves as a building block for more complex molecules. Overall, this compound is valued for its versatility and effectiveness in catalyzing chemical processes.
Formula:C10H10N2
InChI:InChI=1S/C10H10N2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)
InChI key:InChIKey=TYOXIFXYEIILLY-UHFFFAOYSA-N
SMILES:CC=1NC(=NC1)C2=CC=CC=C2
Synonyms:- 1H-Imidazole, 4-methyl-2-phenyl-
- 1H-Imidazole, 5-methyl-2-phenyl-
- 2-Phenyl-4-Methylimidazole
- 2P4Mz
- 4-Methyl-2-Phenyl-1H-Imidazole
- 5-methyl-2-phenyl-1H-imidazole
- Curezol 2P4MZ
- Imidazole, 4(or 5)-methyl-2-phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Imidazole, 5-methyl-2-phenyl-
CAS:Formula:C10H10N2Purity:95%Color and Shape:SolidMolecular weight:158.19984-Methyl-2-phenylimidazole
CAS:Formula:C10H10N2Purity:>93.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:158.204-Methyl-2-phenyl-1H-imidazole
CAS:Formula:C10H10N2Purity:95%Color and Shape:SolidMolecular weight:158.2044-Methyl-2-phenylimidazole
CAS:4-Methyl-2-phenylimidazole is a molecule that has a functional theory. It is used as an inhibitor of corrosion and has been shown to inhibit the activity of magnesium oxide in photoelectron spectroscopy. The molecule has two tautomeric forms, which are the keto form and the enol form. When the molecule is irradiated with light, it absorbs photons and changes into its keto form. Its vibrational modes are also observed in infrared spectroscopy. 4-Methyl-2-phenylimidazole has an activation energy of 6.8 eV and can be classified as stable because it does not decompose at room temperature.Formula:C10H10N2Purity:Min. 95%Molecular weight:158.2 g/mol




