CAS 827-67-8

Hexahydro-2-oxo-1H-azepine-3-acetic acid

Description:

Hexahydro-2-oxo-1H-azepine-3-acetic acid, with the CAS number 827-67-8, is a cyclic compound characterized by its azepine ring structure, which consists of a seven-membered nitrogen-containing heterocycle. This compound features a ketone functional group and an acetic acid moiety, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the nitrogen atom in the ring can impart basic properties, while the carboxylic acid group can participate in various chemical reactions, such as esterification and amidation. Hexahydro-2-oxo-1H-azepine-3-acetic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a unique structure that may serve as a building block for more complex molecules in chemical synthesis and drug development.

Formula: C₈H₁₃NO₃

InChI: InChI=1S/C8H13NO3/c10-7(11)5-6-3-1-2-4-9-8(6)12/h6H,1-5H2,(H,9,12)(H,10,11)

InChI key: InChIKey=KDKKRNOYSMNNJF-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1C(=O)NCCCC1

Synonyms:

• Azepine-3-acetic acid, hexahydro-2-oxo-
• 1H-Azepine-3-acetic acid, hexahydro-2-oxo-
• 2-(2-Oxoazepan-3-yl)acetic acid
• Hexahydro-2-oxo-1H-azepine-3-acetic acid

2-(2-Oxoazepan-3-yl)acetic Acid

Controlled Product

CAS: 827-67-8

Formula: C₈H₁₃NO₃

Color and Shape: Neat

Molecular weight: 171.194

Ref: TR-O991455