CAS 827-81-6
:1,3-benzodioxole-2-carboxylic acid
Description:
1,3-Benzodioxole-2-carboxylic acid, with the CAS number 827-81-6, is an organic compound characterized by its unique bicyclic structure that includes a benzodioxole moiety and a carboxylic acid functional group. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar organic solvents and exhibits moderate solubility in water, which is influenced by the presence of the carboxylic acid group. The compound is known for its potential applications in pharmaceuticals and organic synthesis, often serving as an intermediate in the production of various bioactive molecules. Its chemical properties include the ability to undergo typical reactions associated with carboxylic acids, such as esterification and acid-base reactions. Additionally, the presence of the dioxole ring may impart specific electronic properties, making it of interest in materials science and medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H6O4
InChI:InChI=1/C8H6O4/c9-7(10)8-11-5-3-1-2-4-6(5)12-8/h1-4,8H,(H,9,10)
SMILES:c1ccc2c(c1)OC(C(=O)O)O2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
