CAS 82700-02-5

α-Methylcyclooctaneethanamine

Description:

α-Methylcyclooctaneethanamine, identified by its CAS number 82700-02-5, is an organic compound characterized by its unique structure that includes a cyclooctane ring substituted with an ethylamine group and a methyl group. This compound is typically a colorless to pale yellow liquid at room temperature and possesses a distinctive amine odor. Its molecular structure contributes to its physical properties, such as moderate solubility in water and higher solubility in organic solvents. α-Methylcyclooctaneethanamine may exhibit basic properties due to the presence of the amine functional group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, it may serve as an intermediate in the synthesis of pharmaceuticals or other organic compounds. Safety data indicates that, like many amines, it should be handled with care due to potential irritant effects on the skin and respiratory system. Proper storage and handling protocols are essential to ensure safety in laboratory or industrial settings.

Formula: C₁₁H₂₃N

InChI: InChI=1S/C11H23N/c1-10(12)9-11-7-5-3-2-4-6-8-11/h10-11H,2-9,12H2,1H3

InChI key: InChIKey=LGIMXTCWSDSTPO-UHFFFAOYSA-N

SMILES: C(C(C)N)C1CCCCCCC1

Synonyms:

• α-Methylcyclooctaneethanamine
• Cyclooctaneethylamine, α-methyl-
• Cyclooctaneethanamine, α-methyl-
• 1-Cyclooctylpropan-2-amine