
CAS 82701-58-4
:2-[[4-[2-(2-Chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl 2-methyl-2-propenoate
Description:
The chemical substance known as 2-[[4-[2-(2-Chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl 2-methyl-2-propenoate, with the CAS number 82701-58-4, is a complex organic compound characterized by its azo dye structure, which includes a diazenyl group (-N=N-) that contributes to its chromophoric properties. This compound features a chloro and nitro substituent on the aromatic ring, which can influence its reactivity and solubility. The presence of an ethylamino group suggests potential basicity, while the 2-methyl-2-propenoate moiety indicates that it may participate in polymerization reactions, making it of interest in materials science and dye chemistry. Its structural complexity may also impart unique optical properties, making it suitable for applications in dyeing and as a potential indicator in various chemical processes. Safety and handling precautions are essential due to the presence of chlorine and nitro groups, which can pose health risks. Overall, this compound exemplifies the intricate interplay of functional groups in organic chemistry, influencing both its physical and chemical behavior.
Formula:C20H21ClN4O4
InChI:InChI=1S/C20H21ClN4O4/c1-4-24(11-12-29-20(26)14(2)3)16-7-5-15(6-8-16)22-23-19-10-9-17(25(27)28)13-18(19)21/h5-10,13H,2,4,11-12H2,1,3H3
InChI key:InChIKey=UJXGDBTUUWCZLZ-UHFFFAOYSA-N
SMILES:N(CCOC(C(C)=C)=O)(CC)C1=CC=C(N=NC2=C(Cl)C=C(N(=O)=O)C=C2)C=C1
Synonyms:- 2-[[4-[2-(2-Chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl 2-methyl-2-propenoate
- Disperse Red 13 methacrylate
- 2-Propenoic acid, 2-methyl-, 2-[[4-[(2-chloro-4-nitrophenyl)azo]phenyl]ethylamino]ethyl ester
- 2-Propenoic acid, 2-methyl-, 2-[[4-[2-(2-chloro-4-nitrophenyl)diazenyl]phenyl]ethylamino]ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.