CymitQuimica logo

CAS 827014-22-2

:

4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid

Description:
4-[3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid is a chemical compound characterized by its unique structure, which includes a butanoic acid moiety linked to a 1,2,4-oxadiazole ring substituted with a 2-chlorophenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the oxadiazole ring often contributes to its stability and reactivity, while the chlorophenyl group may influence its interaction with biological targets. Additionally, the carboxylic acid functional group can participate in hydrogen bonding, affecting its solubility and reactivity in various environments. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many such compounds, its specific characteristics, including melting point, boiling point, and spectral properties, would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C12H11ClN2O3
InChI:InChI=1/C12H11ClN2O3/c13-9-5-2-1-4-8(9)12-14-10(18-15-12)6-3-7-11(16)17/h1-2,4-5H,3,6-7H2,(H,16,17)
SMILES:c1ccc(c(c1)c1nc(CCCC(=O)O)on1)Cl
Synonyms:
  • 1,2,4-Oxadiazole-5-Butanoic Acid, 3-(2-Chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.