CymitQuimica logo

CAS 827026-60-8

:

1,3,4-Thiadiazole-2-sulfonic acid, 5-(acetylamino)-

Description:
1,3,4-Thiadiazole-2-sulfonic acid, 5-(acetylamino)- is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features a sulfonic acid group, contributing to its acidic properties and enhancing its solubility in water. The acetylamino group at the 5-position introduces an amide functionality, which can participate in various chemical reactions, making it a versatile building block in organic synthesis. The presence of these functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in the synthesis of more complex molecules. Additionally, the compound's structure may impart specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Overall, 1,3,4-Thiadiazole-2-sulfonic acid, 5-(acetylamino)- is notable for its unique structural features and potential utility in various chemical applications.
Formula:C4H5N3O4S2
InChI:InChI=1S/C4H5N3O4S2/c1-2(8)5-3-6-7-4(12-3)13(9,10)11/h1H3,(H,5,6,8)(H,9,10,11)
InChI key:YLYWNBBQDHCLJL-UHFFFAOYSA-N
SMILES:CC(=O)NC1=NN=C(S1)S(=O)(=O)O
Found 6 products.