CymitQuimica logo

CAS 827027-25-8

:

CHOLINE BIS(TRIFLUOROMETHYLSULFONYL)IMIDE

Description:
Choline bis(trifluoromethylsulfonyl)imide, with the CAS number 827027-25-8, is an ionic liquid characterized by its unique structure and properties. It consists of a choline cation and a bis(trifluoromethylsulfonyl)imide anion, which contributes to its high thermal stability and low volatility. This compound is typically colorless to pale yellow and exhibits excellent solubility in various organic solvents, making it suitable for a range of applications in organic synthesis and electrochemistry. Its ionic nature imparts good conductivity, which is beneficial for use in batteries and supercapacitors. Additionally, choline bis(trifluoromethylsulfonyl)imide is known for its non-hygroscopic nature and low toxicity, making it an attractive alternative to traditional solvents and electrolytes. The trifluoromethylsulfonyl groups enhance its chemical stability and solvation properties, allowing it to function effectively in diverse chemical environments. Overall, this compound is valued for its unique combination of properties that facilitate its use in advanced materials and energy storage technologies.
Formula:C7H14F6N2O5S2
InChI:InChI=1S/C5H14NO.C2F6NO4S2/c1-6(2,3)4-5-7;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7H,4-5H2,1-3H3;/q+1;-1
InChI key:XFXJXURAALDGSW-UHFFFAOYSA-N
SMILES:C[N+](C)(C)CCO.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
Found 4 products.