CymitQuimica logo

CAS 827034-60-6

:

[1-(cyclopropylmethyl)pyrrolidin-2-yl]methanol

Description:
[1-(Cyclopropylmethyl)pyrrolidin-2-yl]methanol, with the CAS number 827034-60-6, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a cyclopropylmethyl group, contributing to its overall molecular complexity. The presence of a hydroxymethyl group (-CH2OH) indicates that it is an alcohol, which can influence its solubility and reactivity. This compound may exhibit interesting pharmacological properties due to its structural motifs, potentially interacting with biological targets in a manner similar to other pyrrolidine derivatives. Its molecular structure suggests it could participate in hydrogen bonding, affecting its physical properties such as boiling point and solubility in polar solvents. Additionally, the cyclopropyl group may impart unique steric and electronic characteristics, influencing the compound's behavior in chemical reactions. Overall, [1-(cyclopropylmethyl)pyrrolidin-2-yl]methanol represents a compound of interest in medicinal chemistry and organic synthesis.
Formula:C9H17NO
InChI:InChI=1/C9H17NO/c11-7-9-2-1-5-10(9)6-8-3-4-8/h8-9,11H,1-7H2
SMILES:C1CC(CO)N(C1)CC1CC1
Synonyms:
  • 2-Pyrrolidinemethanol, 1-(Cyclopropylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.