CAS 827042-23-9

N,N-dimethylbenzotriazole-1-carboxamidine hydrochloride

Description:

N,N-Dimethylbenzotriazole-1-carboxamidine hydrochloride is a chemical compound characterized by its unique structure, which includes a benzotriazole ring and a carboxamidine functional group. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. It is often utilized in the field of organic synthesis and as a reagent in chemical reactions due to its ability to act as a nucleophile. The presence of the dimethyl groups enhances its stability and solubility. Additionally, the hydrochloride form indicates that it is a salt, which can influence its properties, such as solubility and reactivity. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards. Overall, N,N-dimethylbenzotriazole-1-carboxamidine hydrochloride is a valuable compound in research and industrial applications, particularly in the synthesis of various organic molecules.

Formula: C₉H₁₂ClN₅

InChI: InChI=1/C9H11N5.ClH/c1-13(2)9(10)14-8-6-4-3-5-7(8)11-12-14;/h3-6,10H,1-2H3;1H

SMILES: CN(C)C(=N)n1c2ccccc2nn1.Cl

N,N-Dimethyl-1H-benzotriazole-1-carboximidamide Monohydrochloride

Controlled Product

CAS: 827042-23-9

Formula: C₉H₁₁N₅·ClH

Color and Shape: Neat

Molecular weight: 225.68

Ref: TR-D464700