CAS 82711-99-7
:5-Fluoro-2-nitrobenzenesulfonic acid
Description:
5-Fluoro-2-nitrobenzenesulfonic acid is an aromatic sulfonic acid characterized by the presence of a sulfonic acid group (-SO3H), a nitro group (-NO2), and a fluorine atom attached to a benzene ring. This compound typically appears as a solid and is soluble in polar solvents due to its ionic sulfonic acid group. The presence of the nitro and fluoro substituents can influence its reactivity and polarity, making it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. It may exhibit acidic properties, allowing it to act as a proton donor in chemical reactions. Additionally, the compound's structure suggests potential applications in electrophilic aromatic substitution reactions, where the electron-withdrawing groups can direct further substitution on the aromatic ring. Safety precautions should be taken when handling this compound, as it may be harmful or irritant. Overall, 5-Fluoro-2-nitrobenzenesulfonic acid is a valuable intermediate in organic synthesis, contributing to the development of more complex chemical entities.
Formula:C6H4FNO5S
InChI:InChI=1S/C6H4FNO5S/c7-4-1-2-5(8(9)10)6(3-4)14(11,12)13/h1-3H,(H,11,12,13)
InChI key:InChIKey=KPWHHDVNRKIFRI-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(N(=O)=O)C=CC(F)=C1
Synonyms:- 5-Fluoro-2-nitrobenzenesulfonic acid
- Benzenesulfonic acid, 5-fluoro-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.