CAS 82716-88-9

2-(Phenylmethyl) 3,4-dihydro-2,3(1H)-isoquinolinedicarboxylate

Description:

2-(Phenylmethyl) 3,4-dihydro-2,3(1H)-isoquinolinedicarboxylate, with the CAS number 82716-88-9, is a chemical compound that belongs to the class of isoquinoline derivatives. This compound features a bicyclic structure that includes a dihydroisoquinoline moiety, which is characterized by its fused ring system. The presence of the phenylmethyl group contributes to its aromatic properties, while the dicarboxylate functional groups enhance its reactivity and potential for forming various derivatives. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The solubility and stability of this compound can vary depending on the solvent and environmental conditions. Additionally, its synthesis often involves multi-step organic reactions, which may include cyclization and esterification processes. Overall, 2-(Phenylmethyl) 3,4-dihydro-2,3(1H)-isoquinolinedicarboxylate represents a structurally complex molecule with potential applications in pharmacology and organic synthesis.

Formula: C₁₈H₁₇NO₄

InChI: InChI=1S/C18H17NO4/c20-17(21)16-10-14-8-4-5-9-15(14)11-19(16)18(22)23-12-13-6-2-1-3-7-13/h1-9,16H,10-12H2,(H,20,21)

InChI key: InChIKey=YWVQGUBCAUFBCP-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2C(C(O)=O)CC=3C(C2)=CC=CC3

Synonyms:

• 2,3(1H)-Isoquinolinedicarboxylic acid, 3,4-dihydro-, 2-(phenylmethyl) ester
• 2-(Phenylmethyl) 3,4-dihydro-2,3(1H)-isoquinolinedicarboxylate
• 2-[(Benzyloxy)carbonyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid